C26H30O2S6 — CID 20768450
S-[3-[[3-(2-methylprop-2-enoylsulfanyl)-2-phenylsulfanylpropyl]disulfanyl]-2-phenylsulfanylpropyl] 2-methylprop-2-enethioate (PubChem CID 20768450) has the molecular formula C26H30O2S6 and a molecular weight of 566.93 g/mol. Its IUPAC name is S-[3-[[3-(2-methylprop-2-enoylsulfanyl)-2-phenylsulfanylpropyl]disulfanyl]-2-phenylsulfanylpropyl] 2-methylprop-2-enethioate.
| Compound Name | S-[3-[[3-(2-methylprop-2-enoylsulfanyl)-2-phenylsulfanylpropyl]disulfanyl]-2-phenylsulfanylpropyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 20768450 |
| Molecular Formula | C26H30O2S6 |
| Molecular Weight | 566.93 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | S-[3-[[3-(2-methylprop-2-enoylsulfanyl)-2-phenylsulfanylpropyl]disulfanyl]-2-phenylsulfanylpropyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCC(CSSCC(CSC(=O)C(=C)C)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H30O2S6/c1-19(2)25(27)29-15-23(33-21-11-7-5-8-12-21)17-31-32-18-24(16-30-26(28)20(3)4)34-22-13-9-6-10-14-22/h5-14,23-24H,1,3,15-18H2,2,4H3 |
| InChIKey | MRJXLESMYASMIP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.93 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|