C19H28O2S — CID 101136669
2,4-dimethylpentan-3-yl (2S)-4-methyl-2-phenylsulfanylpent-4-enoate (PubChem CID 101136669) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (2S)-4-methyl-2-phenylsulfanylpent-4-enoate.
| Compound Name | 2,4-dimethylpentan-3-yl (2S)-4-methyl-2-phenylsulfanylpent-4-enoate |
|---|---|
| PubChem CID | 101136669 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (2S)-4-methyl-2-phenylsulfanylpent-4-enoate |
| SMILES | C=C(C)C[C@H](Sc1ccccc1)C(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C19H28O2S/c1-13(2)12-17(22-16-10-8-7-9-11-16)19(20)21-18(14(3)4)15(5)6/h7-11,14-15,17-18H,1,12H2,2-6H3/t17-/m0/s1 |
| InChIKey | GXHMMBDMLHTOQR-KRWDZBQOSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|