C18H30OS — CID 123480686
1-(2,2-dimethylpentan-3-yl)-4-(1-propoxyethylsulfanyl)benzene (PubChem CID 123480686) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 1-(2,2-dimethylpentan-3-yl)-4-(1-propoxyethylsulfanyl)benzene.
| Compound Name | 1-(2,2-dimethylpentan-3-yl)-4-(1-propoxyethylsulfanyl)benzene |
|---|---|
| PubChem CID | 123480686 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-(2,2-dimethylpentan-3-yl)-4-(1-propoxyethylsulfanyl)benzene |
| SMILES | CCCOC(C)Sc1ccc(C(CC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30OS/c1-7-13-19-14(3)20-16-11-9-15(10-12-16)17(8-2)18(4,5)6/h9-12,14,17H,7-8,13H2,1-6H3 |
| InChIKey | FVJHHLHWIRGZEU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|