C26H28N2O6S3 — CID 87483203
[ethyl-[4-[4-[ethyl(2-methylprop-2-enoyloxy)carbamoyl]sulfanylphenyl]sulfanylphenyl]sulfanylcarbonylamino] 2-methylprop-2-enoate (PubChem CID 87483203) has the molecular formula C26H28N2O6S3 and a molecular weight of 560.72 g/mol. Its IUPAC name is [ethyl-[4-[4-[ethyl(2-methylprop-2-enoyloxy)carbamoyl]sulfanylphenyl]sulfanylphenyl]sulfanylcarbonylamino] 2-methylprop-2-enoate.
| Compound Name | [ethyl-[4-[4-[ethyl(2-methylprop-2-enoyloxy)carbamoyl]sulfanylphenyl]sulfanylphenyl]sulfanylcarbonylamino] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87483203 |
| Molecular Formula | C26H28N2O6S3 |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | [ethyl-[4-[4-[ethyl(2-methylprop-2-enoyloxy)carbamoyl]sulfanylphenyl]sulfanylphenyl]sulfanylcarbonylamino] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)ON(CC)C(=O)Sc1ccc(Sc2ccc(SC(=O)N(CC)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C26H28N2O6S3/c1-7-27(33-23(29)17(3)4)25(31)36-21-13-9-19(10-14-21)35-20-11-15-22(16-12-20)37-26(32)28(8-2)34-24(30)18(5)6/h9-16H,3,5,7-8H2,1-2,4,6H3 |
| InChIKey | INGQDIJBJXCGQF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|