C26H30O6S — CID 176691619
[4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl]sulfanyl-2,6-dimethylphenoxy]methyl 2-methylprop-2-enoate (PubChem CID 176691619) has the molecular formula C26H30O6S and a molecular weight of 470.59 g/mol. Its IUPAC name is [4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl]sulfanyl-2,6-dimethylphenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl]sulfanyl-2,6-dimethylphenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176691619 |
| Molecular Formula | C26H30O6S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [4-[3,5-dimethyl-4-(2-methylprop-2-enoyloxymethoxy)phenyl]sulfanyl-2,6-dimethylphenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1c(C)cc(Sc2cc(C)c(OCOC(=O)C(=C)C)c(C)c2)cc1C |
| InChI | InChI=1S/C26H30O6S/c1-15(2)25(27)31-13-29-23-17(5)9-21(10-18(23)6)33-22-11-19(7)24(20(8)12-22)30-14-32-26(28)16(3)4/h9-12H,1,3,13-14H2,2,4-8H3 |
| InChIKey | YWFWFUPSTUQRGN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|