C18H22O12 — CID 170394745
2-O-[[2-[2-(2-methylidenebutanoyloxy)ethoxy]-2-oxoacetyl]oxymethyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate (PubChem CID 170394745) has the molecular formula C18H22O12 and a molecular weight of 430.36 g/mol. Its IUPAC name is 2-O-[[2-[2-(2-methylidenebutanoyloxy)ethoxy]-2-oxoacetyl]oxymethyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate.
| Compound Name | 2-O-[[2-[2-(2-methylidenebutanoyloxy)ethoxy]-2-oxoacetyl]oxymethyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate |
|---|---|
| PubChem CID | 170394745 |
| Molecular Formula | C18H22O12 |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-O-[[2-[2-(2-methylidenebutanoyloxy)ethoxy]-2-oxoacetyl]oxymethyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] oxalate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=O)OCOC(=O)C(=O)OCCOC(=O)C(=C)CC |
| InChI | InChI=1S/C18H22O12/c1-5-12(4)14(20)26-7-9-28-16(22)18(24)30-10-29-17(23)15(21)27-8-6-25-13(19)11(2)3/h2,4-10H2,1,3H3 |
| InChIKey | OUCYDDCVZOIWFV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|