C28H34O6S — CID 176691620
1-[4-[4-[1-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylphenoxy]butyl 2-methylprop-2-enoate (PubChem CID 176691620) has the molecular formula C28H34O6S and a molecular weight of 498.64 g/mol. Its IUPAC name is 1-[4-[4-[1-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylphenoxy]butyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-[4-[1-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylphenoxy]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176691620 |
| Molecular Formula | C28H34O6S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-[4-[4-[1-(2-methylprop-2-enoyloxy)butoxy]phenyl]sulfanylphenoxy]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)Oc1ccc(Sc2ccc(OC(CCC)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C28H34O6S/c1-7-9-25(33-27(29)19(3)4)31-21-11-15-23(16-12-21)35-24-17-13-22(14-18-24)32-26(10-8-2)34-28(30)20(5)6/h11-18,25-26H,3,5,7-10H2,1-2,4,6H3 |
| InChIKey | KBRSJVHOANODNK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|