C36H41N3O4 — CID 136994075
1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-hydroxyphenoxy]undecyl 2-methylprop-2-enoate (PubChem CID 136994075) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is 1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-hydroxyphenoxy]undecyl 2-methylprop-2-enoate.
| Compound Name | 1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-hydroxyphenoxy]undecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 136994075 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-hydroxyphenoxy]undecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCCCCCC)Oc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C36H41N3O4/c1-4-5-6-7-8-9-10-17-22-32(43-36(41)26(2)3)42-29-23-24-30(31(40)25-29)35-38-33(27-18-13-11-14-19-27)37-34(39-35)28-20-15-12-16-21-28/h11-16,18-21,23-25,32,40H,2,4-10,17,22H2,1,3H3 |
| InChIKey | QWZBMIGBCSVRAL-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|