C15H18O4 — CID 59237709
1-(4-acetylphenoxy)butyl prop-2-enoate (PubChem CID 59237709) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-(4-acetylphenoxy)butyl prop-2-enoate.
| Compound Name | 1-(4-acetylphenoxy)butyl prop-2-enoate |
|---|---|
| PubChem CID | 59237709 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(4-acetylphenoxy)butyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)Oc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H18O4/c1-4-6-15(19-14(17)5-2)18-13-9-7-12(8-10-13)11(3)16/h5,7-10,15H,2,4,6H2,1,3H3 |
| InChIKey | JWAMDJPBNLQQDT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|