C35H42O7 — CID 122424910
[4-[(4-hexoxyphenyl)methoxy]phenyl] 4-(1-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 122424910) has the molecular formula C35H42O7 and a molecular weight of 574.71 g/mol. Its IUPAC name is [4-[(4-hexoxyphenyl)methoxy]phenyl] 4-(1-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[(4-hexoxyphenyl)methoxy]phenyl] 4-(1-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 122424910 |
| Molecular Formula | C35H42O7 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | [4-[(4-hexoxyphenyl)methoxy]phenyl] 4-(1-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OC(CCCCC)Oc1ccc(C(=O)Oc2ccc(OCc3ccc(OCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H42O7/c1-4-7-9-11-25-38-29-17-13-27(14-18-29)26-39-30-21-23-32(24-22-30)41-35(37)28-15-19-31(20-16-28)40-34(12-10-8-5-2)42-33(36)6-3/h6,13-24,34H,3-5,7-12,25-26H2,1-2H3 |
| InChIKey | RCPKHJNXVNTHJQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|