C24H24O6 — CID 89276913
[4-(1-prop-2-enoyloxypentoxy)phenyl] 4-prop-2-enoylbenzoate (PubChem CID 89276913) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is [4-(1-prop-2-enoyloxypentoxy)phenyl] 4-prop-2-enoylbenzoate.
| Compound Name | [4-(1-prop-2-enoyloxypentoxy)phenyl] 4-prop-2-enoylbenzoate |
|---|---|
| PubChem CID | 89276913 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [4-(1-prop-2-enoyloxypentoxy)phenyl] 4-prop-2-enoylbenzoate |
| SMILES | C=CC(=O)OC(CCCC)Oc1ccc(OC(=O)c2ccc(C(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C24H24O6/c1-4-7-8-23(30-22(26)6-3)28-19-13-15-20(16-14-19)29-24(27)18-11-9-17(10-12-18)21(25)5-2/h5-6,9-16,23H,2-4,7-8H2,1H3 |
| InChIKey | ANPUTIZRZMLSIM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|