C34H44O8 — CID 88849566
[4-(1-prop-2-enoyloxyoctoxy)phenyl] 4-(2-formyl-4-hydroxynon-1-en-5-yl)oxybenzoate (PubChem CID 88849566) has the molecular formula C34H44O8 and a molecular weight of 580.72 g/mol. Its IUPAC name is [4-(1-prop-2-enoyloxyoctoxy)phenyl] 4-(2-formyl-4-hydroxynon-1-en-5-yl)oxybenzoate.
| Compound Name | [4-(1-prop-2-enoyloxyoctoxy)phenyl] 4-(2-formyl-4-hydroxynon-1-en-5-yl)oxybenzoate |
|---|---|
| PubChem CID | 88849566 |
| Molecular Formula | C34H44O8 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | [4-(1-prop-2-enoyloxyoctoxy)phenyl] 4-(2-formyl-4-hydroxynon-1-en-5-yl)oxybenzoate |
| SMILES | C=CC(=O)OC(CCCCCCC)Oc1ccc(OC(=O)c2ccc(OC(CCCC)C(O)CC(=C)C=O)cc2)cc1 |
| InChI | InChI=1S/C34H44O8/c1-5-8-10-11-12-14-33(42-32(37)7-3)40-28-19-21-29(22-20-28)41-34(38)26-15-17-27(18-16-26)39-31(13-9-6-2)30(36)23-25(4)24-35/h7,15-22,24,30-31,33,36H,3-6,8-14,23H2,1-2H3 |
| InChIKey | ZWINNFHHBJDNHV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|