C34H44O6 — CID 88849498
[4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoate (PubChem CID 88849498) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoate.
| Compound Name | [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoate |
|---|---|
| PubChem CID | 88849498 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoate |
| SMILES | C=C(C=O)CC(O)C(CCCCCCCC)Oc1ccc(C(=O)OC2=CC=C(C3=CC=C(OC)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H44O6/c1-4-5-6-7-8-9-10-33(32(36)23-25(2)24-35)39-30-21-15-28(16-22-30)34(37)40-31-19-13-27(14-20-31)26-11-17-29(38-3)18-12-26/h11,13,15-17,19,21-22,24,32-33,36H,2,4-10,12,14,18,20,23H2,1,3H3 |
| InChIKey | JWPGNGQHGBRTHI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|