C29H38O7 — CID 88849517
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxyundec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 88849517) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is [4-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxyundec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxyundec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 88849517 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxyundec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C=O)CC(O)C(CCCCCC)OC1=CC=C(C(=O)OC2=CC=C(/C=C/C(=O)OC)CC2)CC1 |
| InChI | InChI=1S/C29H38O7/c1-4-5-6-7-8-27(26(31)19-21(2)20-30)35-24-16-12-23(13-17-24)29(33)36-25-14-9-22(10-15-25)11-18-28(32)34-3/h9,11-12,14,16,18,20,26-27,31H,2,4-8,10,13,15,17,19H2,1,3H3/b18-11+ |
| InChIKey | ANRKVAGKKXMDDA-WOJGMQOQSA-N |
| XLogP | 5.33 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|