C21H30O5 — CID 88849548
4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoic acid (PubChem CID 88849548) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoic acid.
| Compound Name | 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 88849548 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-(2-formyl-4-hydroxytridec-1-en-5-yl)oxybenzoic acid |
| SMILES | C=C(C=O)CC(O)C(CCCCCCCC)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H30O5/c1-3-4-5-6-7-8-9-20(19(23)14-16(2)15-22)26-18-12-10-17(11-13-18)21(24)25/h10-13,15,19-20,23H,2-9,14H2,1H3,(H,24,25) |
| InChIKey | KSANVDXCUPAYQJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|