C33H44O6 — CID 88849545
[4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxydodec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 88849545) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxydodec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxydodec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 88849545 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | [4-(4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl] 4-(2-formyl-4-hydroxydodec-1-en-5-yl)oxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C=O)CC(O)C(CCCCCCC)OC1=CC=C(C(=O)OC2=CC=C(C3=CC=C(OC)CC3)CC2)CC1 |
| InChI | InChI=1S/C33H44O6/c1-4-5-6-7-8-9-32(31(35)22-24(2)23-34)38-29-20-14-27(15-21-29)33(36)39-30-18-12-26(13-19-30)25-10-16-28(37-3)17-11-25/h10,12,14,16,18,20,23,31-32,35H,2,4-9,11,13,15,17,19,21-22H2,1,3H3 |
| InChIKey | WUKUZRSHBMYEDJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|