C39H50O8 — CID 88849544
[4-[4-(1-prop-2-enoyloxybutoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl] 4-[1-(4-methylidene-5-oxooxolan-2-yl)octoxy]cyclohexa-1,3-diene-1-carboxylate (PubChem CID 88849544) has the molecular formula C39H50O8 and a molecular weight of 646.82 g/mol. Its IUPAC name is [4-[4-(1-prop-2-enoyloxybutoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl] 4-[1-(4-methylidene-5-oxooxolan-2-yl)octoxy]cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [4-[4-(1-prop-2-enoyloxybutoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl] 4-[1-(4-methylidene-5-oxooxolan-2-yl)octoxy]cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 88849544 |
| Molecular Formula | C39H50O8 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | [4-[4-(1-prop-2-enoyloxybutoxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl] 4-[1-(4-methylidene-5-oxooxolan-2-yl)octoxy]cyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=CC(=O)OC(CCC)OC1=CC=C(C2=CC=C(OC(=O)C3=CC=C(OC(CCCCCCC)C4CC(=C)C(=O)O4)CC3)CC2)CC1 |
| InChI | InChI=1S/C39H50O8/c1-5-8-9-10-11-13-34(35-26-27(4)38(41)46-35)43-31-24-18-30(19-25-31)39(42)45-33-22-16-29(17-23-33)28-14-20-32(21-15-28)44-37(12-6-2)47-36(40)7-3/h7,14,16,18,20,22,24,34-35,37H,3-6,8-13,15,17,19,21,23,25-26H2,1-2H3 |
| InChIKey | SMUFMUMHTMGNMK-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|