C27H28O5 — CID 89178493
3-methylidene-5-[4-[4-[1-(4-methylidene-5-oxooxolan-2-yl)pentoxy]phenyl]phenyl]oxolan-2-one (PubChem CID 89178493) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-methylidene-5-[4-[4-[1-(4-methylidene-5-oxooxolan-2-yl)pentoxy]phenyl]phenyl]oxolan-2-one.
| Compound Name | 3-methylidene-5-[4-[4-[1-(4-methylidene-5-oxooxolan-2-yl)pentoxy]phenyl]phenyl]oxolan-2-one |
|---|---|
| PubChem CID | 89178493 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-methylidene-5-[4-[4-[1-(4-methylidene-5-oxooxolan-2-yl)pentoxy]phenyl]phenyl]oxolan-2-one |
| SMILES | C=C1CC(c2ccc(-c3ccc(OC(CCCC)C4CC(=C)C(=O)O4)cc3)cc2)OC1=O |
| InChI | InChI=1S/C27H28O5/c1-4-5-6-23(25-16-18(3)27(29)32-25)30-22-13-11-20(12-14-22)19-7-9-21(10-8-19)24-15-17(2)26(28)31-24/h7-14,23-25H,2-6,15-16H2,1H3 |
| InChIKey | FOTMHFVHSVKHIE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|