C20H26O3 — CID 89178496
5-[1-[4-(4-methylcyclohexyl)phenoxy]ethyl]-3-methylideneoxolan-2-one (PubChem CID 89178496) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-[1-[4-(4-methylcyclohexyl)phenoxy]ethyl]-3-methylideneoxolan-2-one.
| Compound Name | 5-[1-[4-(4-methylcyclohexyl)phenoxy]ethyl]-3-methylideneoxolan-2-one |
|---|---|
| PubChem CID | 89178496 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 5-[1-[4-(4-methylcyclohexyl)phenoxy]ethyl]-3-methylideneoxolan-2-one |
| SMILES | C=C1CC(C(C)Oc2ccc(C3CCC(C)CC3)cc2)OC1=O |
| InChI | InChI=1S/C20H26O3/c1-13-4-6-16(7-5-13)17-8-10-18(11-9-17)22-15(3)19-12-14(2)20(21)23-19/h8-11,13,15-16,19H,2,4-7,12H2,1,3H3 |
| InChIKey | KGKXTASLYCEIMY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|