C23H26F2O — CID 139790644
1-[(E)-1,2-difluoro-2-[4-(4-methylcyclohexyl)phenyl]ethenyl]-4-ethoxybenzene (PubChem CID 139790644) has the molecular formula C23H26F2O and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-[4-(4-methylcyclohexyl)phenyl]ethenyl]-4-ethoxybenzene.
| Compound Name | 1-[(E)-1,2-difluoro-2-[4-(4-methylcyclohexyl)phenyl]ethenyl]-4-ethoxybenzene |
|---|---|
| PubChem CID | 139790644 |
| Molecular Formula | C23H26F2O |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-[4-(4-methylcyclohexyl)phenyl]ethenyl]-4-ethoxybenzene |
| SMILES | CCOc1ccc(/C(F)=C(\F)c2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H26F2O/c1-3-26-21-14-12-20(13-15-21)23(25)22(24)19-10-8-18(9-11-19)17-6-4-16(2)5-7-17/h8-17H,3-7H2,1-2H3/b23-22+ |
| InChIKey | KIEPXSHIWUZRDB-GHVJWSGMSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|