C22H23F3 — CID 175685460
1-[1,2-difluoro-2-(4-fluorophenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene (PubChem CID 175685460) has the molecular formula C22H23F3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-(4-fluorophenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene.
| Compound Name | 1-[1,2-difluoro-2-(4-fluorophenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene |
|---|---|
| PubChem CID | 175685460 |
| Molecular Formula | C22H23F3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[1,2-difluoro-2-(4-fluorophenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene |
| SMILES | CCC1CCC(c2ccc(C(F)=C(F)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H23F3/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)21(24)22(25)19-11-13-20(23)14-12-19/h7-16H,2-6H2,1H3 |
| InChIKey | MOXFJQTXZBKLBW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|