C23H26F2 — CID 139790691
1-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene (PubChem CID 139790691) has the molecular formula C23H26F2 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene.
| Compound Name | 1-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene |
|---|---|
| PubChem CID | 139790691 |
| Molecular Formula | C23H26F2 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-(4-methylphenyl)ethenyl]-4-(4-ethylcyclohexyl)benzene |
| SMILES | CCC1CCC(c2ccc(/C(F)=C(\F)c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H26F2/c1-3-17-6-10-18(11-7-17)19-12-14-21(15-13-19)23(25)22(24)20-8-4-16(2)5-9-20/h4-5,8-9,12-15,17-18H,3,6-7,10-11H2,1-2H3/b23-22+ |
| InChIKey | IUSYOPFMMWGRGT-GHVJWSGMSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|