C15H18O4 — CID 15429931
methyl (2R)-2-[4-[(1S)-3-oxocyclopentyl]phenoxy]propanoate (PubChem CID 15429931) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl (2R)-2-[4-[(1S)-3-oxocyclopentyl]phenoxy]propanoate.
| Compound Name | methyl (2R)-2-[4-[(1S)-3-oxocyclopentyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 15429931 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (2R)-2-[4-[(1S)-3-oxocyclopentyl]phenoxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1ccc([C@H]2CCC(=O)C2)cc1 |
| InChI | InChI=1S/C15H18O4/c1-10(15(17)18-2)19-14-7-4-11(5-8-14)12-3-6-13(16)9-12/h4-5,7-8,10,12H,3,6,9H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | GPOIWHBMOUJSLT-PWSUYJOCSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |