About [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate
[4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate (PubChem CID 86038322) has the molecular formula C28H38O5
and a molecular weight of 454.61 g/mol. Its IUPAC name is [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate.
Molecular Properties
| Compound Name | [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate |
| PubChem CID | 86038322 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)CC(O)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H38O5/c1-3-5-7-8-10-20-32-25-16-14-23(15-17-25)28(31)33-26-18-12-22(13-19-26)27(30)21-24(29)11-9-6-4-2/h12-19,24,29H,3-11,20-21H2,1-2H3 |
| InChIKey | ABRQIGVMQZIKCN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate?
The IUPAC name of [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate (CID 86038322) is [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate.
What is the SMILES notation for [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate?
The canonical SMILES for [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate is CCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)CC(O)CCCCC)cc2)cc1.
What is the InChIKey of [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate?
The InChIKey is ABRQIGVMQZIKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O5/c1-3-5-7-8-10-20-32-25-16-14-23(15-17-25)28(31)33-26-18-12-22(13-19-26)27(30)21-24(29)11-9-6-4-2/h12-19,24,29H,3-11,20-21H2,1-2H3.
What are the key properties of [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate?
[4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate has a molecular weight of 454.61 g/mol, XLogP of 6.77, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-hydroxyoctanoyl)phenyl] 4-heptoxybenzoate is sourced from PubChem (CID 86038322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).