C30H30O6 — CID 89053451
1-[4-[4-[4-(1-prop-2-enoyloxybutoxy)phenyl]buta-1,3-diynyl]phenoxy]butyl prop-2-enoate (PubChem CID 89053451) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is 1-[4-[4-[4-(1-prop-2-enoyloxybutoxy)phenyl]buta-1,3-diynyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 1-[4-[4-[4-(1-prop-2-enoyloxybutoxy)phenyl]buta-1,3-diynyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 89053451 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[4-[4-[4-(1-prop-2-enoyloxybutoxy)phenyl]buta-1,3-diynyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)Oc1ccc(C#CC#Cc2ccc(OC(CCC)OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C30H30O6/c1-5-11-29(35-27(31)7-3)33-25-19-15-23(16-20-25)13-9-10-14-24-17-21-26(22-18-24)34-30(12-6-2)36-28(32)8-4/h7-8,15-22,29-30H,3-6,11-12H2,1-2H3 |
| InChIKey | KGUNXWZABNAGLT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|