About S-(2-hydroxyethoxymethyl) 2-methylpropanethioate
S-(2-hydroxyethoxymethyl) 2-methylpropanethioate (PubChem CID 118964659) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is S-(2-hydroxyethoxymethyl) 2-methylpropanethioate.
Molecular Properties
| Compound Name | S-(2-hydroxyethoxymethyl) 2-methylpropanethioate |
| PubChem CID | 118964659 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | S-(2-hydroxyethoxymethyl) 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCOCCO |
| InChI | InChI=1S/C7H14O3S/c1-6(2)7(9)11-5-10-4-3-8/h6,8H,3-5H2,1-2H3 |
| InChIKey | GSZUWWAOMMEOQO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-hydroxyethoxymethyl) 2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-hydroxyethoxymethyl) 2-methylpropanethioate?
The IUPAC name of S-(2-hydroxyethoxymethyl) 2-methylpropanethioate (CID 118964659) is S-(2-hydroxyethoxymethyl) 2-methylpropanethioate.
What is the SMILES notation for S-(2-hydroxyethoxymethyl) 2-methylpropanethioate?
The canonical SMILES for S-(2-hydroxyethoxymethyl) 2-methylpropanethioate is CC(C)C(=O)SCOCCO.
What is the InChIKey of S-(2-hydroxyethoxymethyl) 2-methylpropanethioate?
The InChIKey is GSZUWWAOMMEOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-6(2)7(9)11-5-10-4-3-8/h6,8H,3-5H2,1-2H3.
What are the key properties of S-(2-hydroxyethoxymethyl) 2-methylpropanethioate?
S-(2-hydroxyethoxymethyl) 2-methylpropanethioate has a molecular weight of 178.25 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-hydroxyethoxymethyl) 2-methylpropanethioate is sourced from PubChem (CID 118964659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).