C16H26O3S4 — CID 23563954
S-[2-(2-methylpropanoylsulfanyl)ethyl] 2-methyl-3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propanethioate (PubChem CID 23563954) has the molecular formula C16H26O3S4 and a molecular weight of 394.65 g/mol. Its IUPAC name is S-[2-(2-methylpropanoylsulfanyl)ethyl] 2-methyl-3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propanethioate.
| Compound Name | S-[2-(2-methylpropanoylsulfanyl)ethyl] 2-methyl-3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propanethioate |
|---|---|
| PubChem CID | 23563954 |
| Molecular Formula | C16H26O3S4 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | S-[2-(2-methylpropanoylsulfanyl)ethyl] 2-methyl-3-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]propanethioate |
| SMILES | C=C(C)C(=O)SCCSCC(C)C(=O)SCCSC(=O)C(C)C |
| InChI | InChI=1S/C16H26O3S4/c1-11(2)14(17)21-7-6-20-10-13(5)16(19)23-9-8-22-15(18)12(3)4/h12-13H,1,6-10H2,2-5H3 |
| InChIKey | OFIQQMPQMJMTPS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|