C14H23NO6S — CID 58987181
2-amino-4-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]sulfanylbutanoic acid (PubChem CID 58987181) has the molecular formula C14H23NO6S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-amino-4-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 58987181 |
| Molecular Formula | C14H23NO6S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-amino-4-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]sulfanylbutanoic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C)CSCCC(N)C(=O)O |
| InChI | InChI=1S/C14H23NO6S/c1-9(2)13(18)20-5-6-21-14(19)10(3)8-22-7-4-11(15)12(16)17/h10-11H,1,4-8,15H2,2-3H3,(H,16,17) |
| InChIKey | OJNMICZTUJKQMO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|