About S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate
S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate (PubChem CID 22670182) has the molecular formula C12H20OS4
and a molecular weight of 308.56 g/mol. Its IUPAC name is S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate.
Molecular Properties
| Compound Name | S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate |
| PubChem CID | 22670182 |
| Molecular Formula | C12H20OS4 |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SC(C)CSCCC1CSCS1 |
| InChI | InChI=1S/C12H20OS4/c1-9(2)12(13)17-10(3)6-14-5-4-11-7-15-8-16-11/h10-11H,1,4-8H2,2-3H3 |
| InChIKey | ZSNFHGBKKOBKOW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate?
The IUPAC name of S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate (CID 22670182) is S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate.
What is the SMILES notation for S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate?
The canonical SMILES for S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate is C=C(C)C(=O)SC(C)CSCCC1CSCS1.
What is the InChIKey of S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate?
The InChIKey is ZSNFHGBKKOBKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20OS4/c1-9(2)12(13)17-10(3)6-14-5-4-11-7-15-8-16-11/h10-11H,1,4-8H2,2-3H3.
What are the key properties of S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate?
S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate has a molecular weight of 308.56 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propan-2-yl] 2-methylprop-2-enethioate is sourced from PubChem (CID 22670182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).