C15H26OS4 — CID 142185392
S-[4-methyl-4-[4-(methylsulfanylmethyl)-1,3-dithiolan-2-yl]pentan-2-yl] 2-methylprop-2-enethioate (PubChem CID 142185392) has the molecular formula C15H26OS4 and a molecular weight of 350.64 g/mol. Its IUPAC name is S-[4-methyl-4-[4-(methylsulfanylmethyl)-1,3-dithiolan-2-yl]pentan-2-yl] 2-methylprop-2-enethioate.
| Compound Name | S-[4-methyl-4-[4-(methylsulfanylmethyl)-1,3-dithiolan-2-yl]pentan-2-yl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 142185392 |
| Molecular Formula | C15H26OS4 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | S-[4-methyl-4-[4-(methylsulfanylmethyl)-1,3-dithiolan-2-yl]pentan-2-yl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SC(C)CC(C)(C)C1SCC(CSC)S1 |
| InChI | InChI=1S/C15H26OS4/c1-10(2)13(16)19-11(3)7-15(4,5)14-18-9-12(20-14)8-17-6/h11-12,14H,1,7-9H2,2-6H3 |
| InChIKey | PAGWDMNAIIMRER-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|