C10H18OS3 — CID 157209038
methane;S-[(4-methyl-1,3-dithiolan-2-yl)methyl] 2-methylprop-2-enethioate (PubChem CID 157209038) has the molecular formula C10H18OS3 and a molecular weight of 250.45 g/mol. Its IUPAC name is methane;S-[(4-methyl-1,3-dithiolan-2-yl)methyl] 2-methylprop-2-enethioate.
| Compound Name | methane;S-[(4-methyl-1,3-dithiolan-2-yl)methyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 157209038 |
| Molecular Formula | C10H18OS3 |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methane;S-[(4-methyl-1,3-dithiolan-2-yl)methyl] 2-methylprop-2-enethioate |
| SMILES | C.C=C(C)C(=O)SCC1SCC(C)S1 |
| InChI | InChI=1S/C9H14OS3.CH4/c1-6(2)9(10)12-5-8-11-4-7(3)13-8;/h7-8H,1,4-5H2,2-3H3;1H4 |
| InChIKey | ARRJFGJVOUWFSX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|