C9H14O2S2 — CID 20591145
(4-methyl-1,3-dithiolan-2-yl)methyl 2-methylprop-2-enoate (PubChem CID 20591145) has the molecular formula C9H14O2S2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (4-methyl-1,3-dithiolan-2-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (4-methyl-1,3-dithiolan-2-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20591145 |
| Molecular Formula | C9H14O2S2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (4-methyl-1,3-dithiolan-2-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1SCC(C)S1 |
| InChI | InChI=1S/C9H14O2S2/c1-6(2)9(10)11-4-8-12-5-7(3)13-8/h7-8H,1,4-5H2,2-3H3 |
| InChIKey | YDBVBJLCBGSNOY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|