C11H16O2S4 — CID 153325945
(8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate (PubChem CID 153325945) has the molecular formula C11H16O2S4 and a molecular weight of 308.52 g/mol. Its IUPAC name is (8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153325945 |
| Molecular Formula | C11H16O2S4 |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | (8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CSC2(SCC(C)S2)S1 |
| InChI | InChI=1S/C11H16O2S4/c1-7(2)10(12)13-4-9-6-15-11(17-9)14-5-8(3)16-11/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | PRMGPRHSFZVVRF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|