C12H18O2S4 — CID 150886977
(8-ethyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate (PubChem CID 150886977) has the molecular formula C12H18O2S4 and a molecular weight of 322.54 g/mol. Its IUPAC name is (8-ethyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (8-ethyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150886977 |
| Molecular Formula | C12H18O2S4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (8-ethyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CSC2(SCC(CC)S2)S1 |
| InChI | InChI=1S/C12H18O2S4/c1-4-9-6-15-12(17-9)16-7-10(18-12)5-14-11(13)8(2)3/h9-10H,2,4-7H2,1,3H3 |
| InChIKey | KXFINLKKXHWPDW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|