C18H18OS3 — CID 22670273
S-[(2-naphthalen-1-yl-1,3-dithiolan-4-yl)methyl] 2-methylprop-2-enethioate (PubChem CID 22670273) has the molecular formula C18H18OS3 and a molecular weight of 346.54 g/mol. Its IUPAC name is S-[(2-naphthalen-1-yl-1,3-dithiolan-4-yl)methyl] 2-methylprop-2-enethioate.
| Compound Name | S-[(2-naphthalen-1-yl-1,3-dithiolan-4-yl)methyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 22670273 |
| Molecular Formula | C18H18OS3 |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | S-[(2-naphthalen-1-yl-1,3-dithiolan-4-yl)methyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCC1CSC(c2cccc3ccccc23)S1 |
| InChI | InChI=1S/C18H18OS3/c1-12(2)17(19)20-10-14-11-21-18(22-14)16-9-5-7-13-6-3-4-8-15(13)16/h3-9,14,18H,1,10-11H2,2H3 |
| InChIKey | TWOUSEWPZOQVLN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|