C15H18O2S3 — CID 22670288
(2-phenyl-1,3-dithiolan-4-yl)methylsulfanylmethyl 2-methylprop-2-enoate (PubChem CID 22670288) has the molecular formula C15H18O2S3 and a molecular weight of 326.51 g/mol. Its IUPAC name is (2-phenyl-1,3-dithiolan-4-yl)methylsulfanylmethyl 2-methylprop-2-enoate.
| Compound Name | (2-phenyl-1,3-dithiolan-4-yl)methylsulfanylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22670288 |
| Molecular Formula | C15H18O2S3 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2-phenyl-1,3-dithiolan-4-yl)methylsulfanylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCSCC1CSC(c2ccccc2)S1 |
| InChI | InChI=1S/C15H18O2S3/c1-11(2)14(16)17-10-18-8-13-9-19-15(20-13)12-6-4-3-5-7-12/h3-7,13,15H,1,8-10H2,2H3 |
| InChIKey | CHXRMCZOXAIIJK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|