C20H22O4S4 — CID 22602293
[2-[3-[4-(prop-2-enoyloxymethyl)-1,3-dithiolan-2-yl]phenyl]-1,3-dithiolan-4-yl]methyl prop-2-enoate (PubChem CID 22602293) has the molecular formula C20H22O4S4 and a molecular weight of 454.66 g/mol. Its IUPAC name is [2-[3-[4-(prop-2-enoyloxymethyl)-1,3-dithiolan-2-yl]phenyl]-1,3-dithiolan-4-yl]methyl prop-2-enoate.
| Compound Name | [2-[3-[4-(prop-2-enoyloxymethyl)-1,3-dithiolan-2-yl]phenyl]-1,3-dithiolan-4-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 22602293 |
| Molecular Formula | C20H22O4S4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | [2-[3-[4-(prop-2-enoyloxymethyl)-1,3-dithiolan-2-yl]phenyl]-1,3-dithiolan-4-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CSC(c2cccc(C3SCC(COC(=O)C=C)S3)c2)S1 |
| InChI | InChI=1S/C20H22O4S4/c1-3-17(21)23-9-15-11-25-19(27-15)13-6-5-7-14(8-13)20-26-12-16(28-20)10-24-18(22)4-2/h3-8,15-16,19-20H,1-2,9-12H2 |
| InChIKey | WYSFLOSVRATLED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|