C18H34N2O3S3 — CID 170107981
2-[butyl-[[butyl-[2-(thiiran-2-ylmethoxy)ethyl]amino]disulfanyl]amino]ethyl prop-2-enoate (PubChem CID 170107981) has the molecular formula C18H34N2O3S3 and a molecular weight of 422.68 g/mol. Its IUPAC name is 2-[butyl-[[butyl-[2-(thiiran-2-ylmethoxy)ethyl]amino]disulfanyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[butyl-[[butyl-[2-(thiiran-2-ylmethoxy)ethyl]amino]disulfanyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170107981 |
| Molecular Formula | C18H34N2O3S3 |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[butyl-[[butyl-[2-(thiiran-2-ylmethoxy)ethyl]amino]disulfanyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(CCCC)SSN(CCCC)CCOCC1CS1 |
| InChI | InChI=1S/C18H34N2O3S3/c1-4-7-9-19(11-13-22-15-17-16-24-17)25-26-20(10-8-5-2)12-14-23-18(21)6-3/h6,17H,3-5,7-16H2,1-2H3 |
| InChIKey | ILPCWASWYFAPDV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|