C8H16S4 — CID 22670248
1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propane-2-thiol (PubChem CID 22670248) has the molecular formula C8H16S4 and a molecular weight of 240.48 g/mol. Its IUPAC name is 1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propane-2-thiol.
| Compound Name | 1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propane-2-thiol |
|---|---|
| PubChem CID | 22670248 |
| Molecular Formula | C8H16S4 |
| Molecular Weight | 240.48 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-[2-(1,3-dithiolan-4-yl)ethylsulfanyl]propane-2-thiol |
| SMILES | CC(S)CSCCC1CSCS1 |
| InChI | InChI=1S/C8H16S4/c1-7(9)4-10-3-2-8-5-11-6-12-8/h7-9H,2-6H2,1H3 |
| InChIKey | VVWAWXBLIGFQGQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|