C8H16OS3 — CID 23389559
1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]propan-2-ol (PubChem CID 23389559) has the molecular formula C8H16OS3 and a molecular weight of 224.42 g/mol. Its IUPAC name is 1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]propan-2-ol.
| Compound Name | 1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 23389559 |
| Molecular Formula | C8H16OS3 |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]propan-2-ol |
| SMILES | CC(O)CSCCC1SCCS1 |
| InChI | InChI=1S/C8H16OS3/c1-7(9)6-10-3-2-8-11-4-5-12-8/h7-9H,2-6H2,1H3 |
| InChIKey | KDLXMYPEPORPBV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|