C7H15NO5S — CID 88837703
1-(2-aminoethylsulfanyl)propan-2-ol;oxalic acid (PubChem CID 88837703) has the molecular formula C7H15NO5S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-(2-aminoethylsulfanyl)propan-2-ol;oxalic acid.
| Compound Name | 1-(2-aminoethylsulfanyl)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 88837703 |
| Molecular Formula | C7H15NO5S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 1-(2-aminoethylsulfanyl)propan-2-ol;oxalic acid |
| SMILES | CC(O)CSCCN.O=C(O)C(=O)O |
| InChI | InChI=1S/C5H13NOS.C2H2O4/c1-5(7)4-8-3-2-6;3-1(4)2(5)6/h5,7H,2-4,6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KFMLJAOWJIORIH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|