C8H16N2O4S — CID 84556867
2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 84556867) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 84556867 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)CSCCN)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c1-5(11)7(8(13)14)10-6(12)4-15-3-2-9/h5,7,11H,2-4,9H2,1H3,(H,10,12)(H,13,14) |
| InChIKey | UXFTUYQXOGOUSI-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|