About 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane
2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane (PubChem CID 13199381) has the molecular formula C8H14S4
and a molecular weight of 238.47 g/mol. Its IUPAC name is 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane |
| PubChem CID | 13199381 |
| Molecular Formula | C8H14S4 |
| Molecular Weight | 238.47 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane |
| SMILES | C1CSC(CCC2SCCS2)S1 |
| InChI | InChI=1S/C8H14S4/c1(7-9-3-4-10-7)2-8-11-5-6-12-8/h7-8H,1-6H2 |
| InChIKey | VSOKONKCWGDTBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane?
The IUPAC name of 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane (CID 13199381) is 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane.
What is the SMILES notation for 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane?
The canonical SMILES for 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane is C1CSC(CCC2SCCS2)S1.
What is the InChIKey of 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane?
The InChIKey is VSOKONKCWGDTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S4/c1(7-9-3-4-10-7)2-8-11-5-6-12-8/h7-8H,1-6H2.
What are the key properties of 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane?
2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane has a molecular weight of 238.47 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dithiolane is sourced from PubChem (CID 13199381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).