C5H10S4 — CID 174398696
1-(1,3,5-trithian-2-yl)ethanethiol (PubChem CID 174398696) has the molecular formula C5H10S4 and a molecular weight of 198.40 g/mol. Its IUPAC name is 1-(1,3,5-trithian-2-yl)ethanethiol.
| Compound Name | 1-(1,3,5-trithian-2-yl)ethanethiol |
|---|---|
| PubChem CID | 174398696 |
| Molecular Formula | C5H10S4 |
| Molecular Weight | 198.40 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 1-(1,3,5-trithian-2-yl)ethanethiol |
| SMILES | CC(S)C1SCSCS1 |
| InChI | InChI=1S/C5H10S4/c1-4(6)5-8-2-7-3-9-5/h4-6H,2-3H2,1H3 |
| InChIKey | XTKGEYQRRYHSQI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|