C12H24S6 — CID 87773221
1-[1-[3-[1-(1-sulfanylethylsulfanyl)ethyl]-1,4-dithian-2-yl]ethylsulfanyl]ethanethiol (PubChem CID 87773221) has the molecular formula C12H24S6 and a molecular weight of 360.73 g/mol. Its IUPAC name is 1-[1-[3-[1-(1-sulfanylethylsulfanyl)ethyl]-1,4-dithian-2-yl]ethylsulfanyl]ethanethiol.
| Compound Name | 1-[1-[3-[1-(1-sulfanylethylsulfanyl)ethyl]-1,4-dithian-2-yl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 87773221 |
| Molecular Formula | C12H24S6 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1-[1-[3-[1-(1-sulfanylethylsulfanyl)ethyl]-1,4-dithian-2-yl]ethylsulfanyl]ethanethiol |
| SMILES | CC(S)SC(C)C1SCCSC1C(C)SC(C)S |
| InChI | InChI=1S/C12H24S6/c1-7(17-9(3)13)11-12(16-6-5-15-11)8(2)18-10(4)14/h7-14H,5-6H2,1-4H3 |
| InChIKey | KQGRLOJOJLQASM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|