C5H10O2S — CID 123704944
1-(1,3-dioxolan-2-yl)ethanethiol (PubChem CID 123704944) has the molecular formula C5H10O2S and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)ethanethiol.
| Compound Name | 1-(1,3-dioxolan-2-yl)ethanethiol |
|---|---|
| PubChem CID | 123704944 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)ethanethiol |
| SMILES | CC(S)C1OCCO1 |
| InChI | InChI=1S/C5H10O2S/c1-4(8)5-6-2-3-7-5/h4-5,8H,2-3H2,1H3 |
| InChIKey | JRFNLOGZDHNEEP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|