About magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride
magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride (PubChem CID 173097852) has the molecular formula C6H13BrMgO2
and a molecular weight of 221.38 g/mol. Its IUPAC name is magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride.
Molecular Properties
| Compound Name | magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride |
| PubChem CID | 173097852 |
| Molecular Formula | C6H13BrMgO2 |
| Molecular Weight | 221.38 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride |
| SMILES | CC(Br)C1OCCCO1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C6H11BrO2.Mg.2H/c1-5(7)6-8-3-2-4-9-6;;;/h5-6H,2-4H2,1H3;;;/q;+2;2*-1 |
| InChIKey | DEMNMJIDNWQFAS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride?
The IUPAC name of magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride (CID 173097852) is magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride.
What is the SMILES notation for magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride?
The canonical SMILES for magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride is CC(Br)C1OCCCO1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride?
The InChIKey is DEMNMJIDNWQFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrO2.Mg.2H/c1-5(7)6-8-3-2-4-9-6;;;/h5-6H,2-4H2,1H3;;;/q;+2;2*-1.
What are the key properties of magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride?
magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride has a molecular weight of 221.38 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-(1-bromoethyl)-1,3-dioxane;hydride is sourced from PubChem (CID 173097852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).