C5H10S3 — CID 45096303
3-propan-2-yl-1,2,4-trithiolane (PubChem CID 45096303) has the molecular formula C5H10S3 and a molecular weight of 166.34 g/mol. Its IUPAC name is 3-propan-2-yl-1,2,4-trithiolane.
| Compound Name | 3-propan-2-yl-1,2,4-trithiolane |
|---|---|
| PubChem CID | 45096303 |
| Molecular Formula | C5H10S3 |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | 3-propan-2-yl-1,2,4-trithiolane |
| SMILES | CC(C)C1SCSS1 |
| InChI | InChI=1S/C5H10S3/c1-4(2)5-6-3-7-8-5/h4-5H,3H2,1-2H3 |
| InChIKey | YDKYPHWHCMHUOM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|