C5H10OS3 — CID 22891749
1-(1,3,5-trithian-2-yl)ethanol (PubChem CID 22891749) has the molecular formula C5H10OS3 and a molecular weight of 182.33 g/mol. Its IUPAC name is 1-(1,3,5-trithian-2-yl)ethanol.
| Compound Name | 1-(1,3,5-trithian-2-yl)ethanol |
|---|---|
| PubChem CID | 22891749 |
| Molecular Formula | C5H10OS3 |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1-(1,3,5-trithian-2-yl)ethanol |
| SMILES | CC(O)C1SCSCS1 |
| InChI | InChI=1S/C5H10OS3/c1-4(6)5-8-2-7-3-9-5/h4-6H,2-3H2,1H3 |
| InChIKey | OWXYUVGDRUDTBR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |