C5H10OS2 — CID 174420309
1-(1,3-dithiolan-4-yl)ethanol (PubChem CID 174420309) has the molecular formula C5H10OS2 and a molecular weight of 150.27 g/mol. Its IUPAC name is 1-(1,3-dithiolan-4-yl)ethanol.
| Compound Name | 1-(1,3-dithiolan-4-yl)ethanol |
|---|---|
| PubChem CID | 174420309 |
| Molecular Formula | C5H10OS2 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 1-(1,3-dithiolan-4-yl)ethanol |
| SMILES | CC(O)C1CSCS1 |
| InChI | InChI=1S/C5H10OS2/c1-4(6)5-2-7-3-8-5/h4-6H,2-3H2,1H3 |
| InChIKey | GSZYVVOXXLUUAC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |